C8H9BrF2N2O2S — CID 83022882
2-bromo-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide (PubChem CID 83022882) has the molecular formula C8H9BrF2N2O2S and a molecular weight of 315.14 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide.
| Compound Name | 2-bromo-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 83022882 |
| Molecular Formula | C8H9BrF2N2O2S |
| Molecular Weight | 315.14 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 2-bromo-4,6-difluoro-N',N'-dimethylbenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H9BrF2N2O2S/c1-13(2)12-16(14,15)8-6(9)3-5(10)4-7(8)11/h3-4,12H,1-2H3 |
| InChIKey | XNMPTPYXFHUZLK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.14 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|