C10H10BrF2NO2S — CID 114616375
2-bromo-4,6-difluoro-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 114616375) has the molecular formula C10H10BrF2NO2S and a molecular weight of 326.16 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | 2-bromo-4,6-difluoro-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114616375 |
| Molecular Formula | C10H10BrF2NO2S |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(C)CNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H10BrF2NO2S/c1-6(2)5-14-17(15,16)10-8(11)3-7(12)4-9(10)13/h3-4,14H,1,5H2,2H3 |
| InChIKey | RXHFRIPMOWWBEE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|