C12H17BrF2N2O2S — CID 43606874
2-bromo-4,6-difluoro-N-[3-(propan-2-ylamino)propyl]benzenesulfonamide (PubChem CID 43606874) has the molecular formula C12H17BrF2N2O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-[3-(propan-2-ylamino)propyl]benzenesulfonamide.
| Compound Name | 2-bromo-4,6-difluoro-N-[3-(propan-2-ylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43606874 |
| Molecular Formula | C12H17BrF2N2O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-[3-(propan-2-ylamino)propyl]benzenesulfonamide |
| SMILES | CC(C)NCCCNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H17BrF2N2O2S/c1-8(2)16-4-3-5-17-20(18,19)12-10(13)6-9(14)7-11(12)15/h6-8,16-17H,3-5H2,1-2H3 |
| InChIKey | CSIJSKQJKRBPKM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|