C10H12BrF2NO2S2 — CID 113466867
2-bromo-4,6-difluoro-N-(2-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 113466867) has the molecular formula C10H12BrF2NO2S2 and a molecular weight of 360.25 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(2-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 2-bromo-4,6-difluoro-N-(2-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113466867 |
| Molecular Formula | C10H12BrF2NO2S2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(2-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSC(C)CNS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H12BrF2NO2S2/c1-6(17-2)5-14-18(15,16)10-8(11)3-7(12)4-9(10)13/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | FMXIRNMMKSVRNG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |