C11H13BrF3NO2S — CID 113271251
N-(4-bromo-2-methylbutyl)-2,4,6-trifluorobenzenesulfonamide (PubChem CID 113271251) has the molecular formula C11H13BrF3NO2S and a molecular weight of 360.20 g/mol. Its IUPAC name is N-(4-bromo-2-methylbutyl)-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(4-bromo-2-methylbutyl)-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113271251 |
| Molecular Formula | C11H13BrF3NO2S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-(4-bromo-2-methylbutyl)-2,4,6-trifluorobenzenesulfonamide |
| SMILES | CC(CCBr)CNS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H13BrF3NO2S/c1-7(2-3-12)6-16-19(17,18)11-9(14)4-8(13)5-10(11)15/h4-5,7,16H,2-3,6H2,1H3 |
| InChIKey | GRNXVDXMFNVVNB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|