C9H10F3NO4S — CID 66175412
N-(2,3-dihydroxypropyl)-2,4,6-trifluorobenzenesulfonamide (PubChem CID 66175412) has the molecular formula C9H10F3NO4S and a molecular weight of 285.24 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,4,6-trifluorobenzenesulfonamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,4,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 66175412 |
| Molecular Formula | C9H10F3NO4S |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,4,6-trifluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC(O)CO)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H10F3NO4S/c10-5-1-7(11)9(8(12)2-5)18(16,17)13-3-6(15)4-14/h1-2,6,13-15H,3-4H2 |
| InChIKey | VZAZSFFGBIPJIX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |