C9H13FN2O4S — CID 66175882
5-amino-N-(2,3-dihydroxypropyl)-2-fluorobenzenesulfonamide (PubChem CID 66175882) has the molecular formula C9H13FN2O4S and a molecular weight of 264.28 g/mol. Its IUPAC name is 5-amino-N-(2,3-dihydroxypropyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-amino-N-(2,3-dihydroxypropyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 66175882 |
| Molecular Formula | C9H13FN2O4S |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-amino-N-(2,3-dihydroxypropyl)-2-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(F)c(S(=O)(=O)NCC(O)CO)c1 |
| InChI | InChI=1S/C9H13FN2O4S/c10-8-2-1-6(11)3-9(8)17(15,16)12-4-7(14)5-13/h1-3,7,12-14H,4-5,11H2 |
| InChIKey | QYQCHLJKIWSEHS-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|