C15H17FN2O2S — CID 61109845
5-amino-2-fluoro-N-(2-phenylpropyl)benzenesulfonamide (PubChem CID 61109845) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-(2-phenylpropyl)benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N-(2-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61109845 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 5-amino-2-fluoro-N-(2-phenylpropyl)benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cc(N)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C15H17FN2O2S/c1-11(12-5-3-2-4-6-12)10-18-21(19,20)15-9-13(17)7-8-14(15)16/h2-9,11,18H,10,17H2,1H3 |
| InChIKey | NQDIMRSQUPWTHX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|