C13H21FN2O3S — CID 66179689
5-amino-2-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide (PubChem CID 66179689) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66179689 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-amino-2-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(C)CC(C)(O)CNS(=O)(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C13H21FN2O3S/c1-9(2)7-13(3,17)8-16-20(18,19)12-6-10(15)4-5-11(12)14/h4-6,9,16-17H,7-8,15H2,1-3H3 |
| InChIKey | DPLWXUPEPHSPSZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|