C13H20FNO3S — CID 66179000
3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide (PubChem CID 66179000) has the molecular formula C13H20FNO3S and a molecular weight of 289.37 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66179000 |
| Molecular Formula | C13H20FNO3S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-fluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(C)CC(C)(O)CNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H20FNO3S/c1-10(2)8-13(3,16)9-15-19(17,18)12-6-4-5-11(14)7-12/h4-7,10,15-16H,8-9H2,1-3H3 |
| InChIKey | SJIBQPVLLRDQDI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |