C9H10F3NO3S — CID 104858703
N-(2,2-difluoro-3-hydroxypropyl)-3-fluorobenzenesulfonamide (PubChem CID 104858703) has the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-3-fluorobenzenesulfonamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 104858703 |
| Molecular Formula | C9H10F3NO3S |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)CO)c1cccc(F)c1 |
| InChI | InChI=1S/C9H10F3NO3S/c10-7-2-1-3-8(4-7)17(15,16)13-5-9(11,12)6-14/h1-4,13-14H,5-6H2 |
| InChIKey | QDEZFOOUDJJODI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |