C10H10F2INO5S — CID 106168555
5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-iodobenzoic acid (PubChem CID 106168555) has the molecular formula C10H10F2INO5S and a molecular weight of 421.16 g/mol. Its IUPAC name is 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-iodobenzoic acid.
| Compound Name | 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-iodobenzoic acid |
|---|---|
| PubChem CID | 106168555 |
| Molecular Formula | C10H10F2INO5S |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-2-iodobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC(F)(F)CO)ccc1I |
| InChI | InChI=1S/C10H10F2INO5S/c11-10(12,5-15)4-14-20(18,19)6-1-2-8(13)7(3-6)9(16)17/h1-3,14-15H,4-5H2,(H,16,17) |
| InChIKey | LYHSDFAWJFOXBB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|