C11H14INO5S — CID 113359369
5-(3-hydroxybutylsulfamoyl)-2-iodobenzoic acid (PubChem CID 113359369) has the molecular formula C11H14INO5S and a molecular weight of 399.21 g/mol. Its IUPAC name is 5-(3-hydroxybutylsulfamoyl)-2-iodobenzoic acid.
| Compound Name | 5-(3-hydroxybutylsulfamoyl)-2-iodobenzoic acid |
|---|---|
| PubChem CID | 113359369 |
| Molecular Formula | C11H14INO5S |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 5-(3-hydroxybutylsulfamoyl)-2-iodobenzoic acid |
| SMILES | CC(O)CCNS(=O)(=O)c1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H14INO5S/c1-7(14)4-5-13-19(17,18)8-2-3-10(12)9(6-8)11(15)16/h2-3,6-7,13-14H,4-5H2,1H3,(H,15,16) |
| InChIKey | BFXYMBDVLCJUGV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|