C13H18INO5S — CID 106348559
5-[(1-hydroxy-4-methylpentan-3-yl)sulfamoyl]-2-iodobenzoic acid (PubChem CID 106348559) has the molecular formula C13H18INO5S and a molecular weight of 427.26 g/mol. Its IUPAC name is 5-[(1-hydroxy-4-methylpentan-3-yl)sulfamoyl]-2-iodobenzoic acid.
| Compound Name | 5-[(1-hydroxy-4-methylpentan-3-yl)sulfamoyl]-2-iodobenzoic acid |
|---|---|
| PubChem CID | 106348559 |
| Molecular Formula | C13H18INO5S |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 5-[(1-hydroxy-4-methylpentan-3-yl)sulfamoyl]-2-iodobenzoic acid |
| SMILES | CC(C)C(CCO)NS(=O)(=O)c1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H18INO5S/c1-8(2)12(5-6-16)15-21(19,20)9-3-4-11(14)10(7-9)13(17)18/h3-4,7-8,12,15-16H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | GYGDQEISZYZPCK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|