C11H12INO6S — CID 103962339
2-iodo-5-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]benzoic acid (PubChem CID 103962339) has the molecular formula C11H12INO6S and a molecular weight of 413.19 g/mol. Its IUPAC name is 2-iodo-5-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-iodo-5-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 103962339 |
| Molecular Formula | C11H12INO6S |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 2-iodo-5-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]benzoic acid |
| SMILES | COC(=O)[C@H](C)NS(=O)(=O)c1ccc(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12INO6S/c1-6(11(16)19-2)13-20(17,18)7-3-4-9(12)8(5-7)10(14)15/h3-6,13H,1-2H3,(H,14,15)/t6-/m0/s1 |
| InChIKey | SRQBOYWXPXSICW-LURJTMIESA-N |
| XLogP | 0.83 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|