C11H13IN2O5S — CID 103962395
5-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-2-iodobenzoic acid (PubChem CID 103962395) has the molecular formula C11H13IN2O5S and a molecular weight of 412.21 g/mol. Its IUPAC name is 5-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-2-iodobenzoic acid.
| Compound Name | 5-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-2-iodobenzoic acid |
|---|---|
| PubChem CID | 103962395 |
| Molecular Formula | C11H13IN2O5S |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | 5-[(1-amino-2-methyl-1-oxopropan-2-yl)sulfamoyl]-2-iodobenzoic acid |
| SMILES | CC(C)(NS(=O)(=O)c1ccc(I)c(C(=O)O)c1)C(N)=O |
| InChI | InChI=1S/C11H13IN2O5S/c1-11(2,10(13)17)14-20(18,19)6-3-4-8(12)7(5-6)9(15)16/h3-5,14H,1-2H3,(H2,13,17)(H,15,16) |
| InChIKey | CQZHUBCBWPNVQQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|