C11H8IN3O4S — CID 103962224
2-iodo-5-(pyrimidin-2-ylsulfamoyl)benzoic acid (PubChem CID 103962224) has the molecular formula C11H8IN3O4S and a molecular weight of 405.17 g/mol. Its IUPAC name is 2-iodo-5-(pyrimidin-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-iodo-5-(pyrimidin-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 103962224 |
| Molecular Formula | C11H8IN3O4S |
| Molecular Weight | 405.17 g/mol |
| Exact Mass | 404.93 |
| IUPAC Name | 2-iodo-5-(pyrimidin-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ncccn2)ccc1I |
| InChI | InChI=1S/C11H8IN3O4S/c12-9-3-2-7(6-8(9)10(16)17)20(18,19)15-11-13-4-1-5-14-11/h1-6H,(H,16,17)(H,13,14,15) |
| InChIKey | SEJXTIBTBIFPQU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|