C10H7BrN4O4S — CID 115571544
2-bromo-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid (PubChem CID 115571544) has the molecular formula C10H7BrN4O4S and a molecular weight of 359.16 g/mol. Its IUPAC name is 2-bromo-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid.
| Compound Name | 2-bromo-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 115571544 |
| Molecular Formula | C10H7BrN4O4S |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 2-bromo-5-(1,2,4-triazin-3-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2nccnn2)ccc1Br |
| InChI | InChI=1S/C10H7BrN4O4S/c11-8-2-1-6(5-7(8)9(16)17)20(18,19)15-10-12-3-4-13-14-10/h1-5H,(H,16,17)(H,12,14,15) |
| InChIKey | BPDLELHOEJGVFA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |