C9H6Br2N4O2S — CID 114389146
2,4-dibromo-N-(1,2,4-triazin-3-yl)benzenesulfonamide (PubChem CID 114389146) has the molecular formula C9H6Br2N4O2S and a molecular weight of 394.05 g/mol. Its IUPAC name is 2,4-dibromo-N-(1,2,4-triazin-3-yl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(1,2,4-triazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114389146 |
| Molecular Formula | C9H6Br2N4O2S |
| Molecular Weight | 394.05 g/mol |
| Exact Mass | 391.86 |
| IUPAC Name | 2,4-dibromo-N-(1,2,4-triazin-3-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccnn1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H6Br2N4O2S/c10-6-1-2-8(7(11)5-6)18(16,17)15-9-12-3-4-13-14-9/h1-5H,(H,12,14,15) |
| InChIKey | NYSVKNKBZRFXOY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.05 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |