C11H8Br2N2O2S — CID 60823437
2,4-dibromo-N-pyridin-4-ylbenzenesulfonamide (PubChem CID 60823437) has the molecular formula C11H8Br2N2O2S and a molecular weight of 392.07 g/mol. Its IUPAC name is 2,4-dibromo-N-pyridin-4-ylbenzenesulfonamide.
| Compound Name | 2,4-dibromo-N-pyridin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 60823437 |
| Molecular Formula | C11H8Br2N2O2S |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 389.87 |
| IUPAC Name | 2,4-dibromo-N-pyridin-4-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccncc1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H8Br2N2O2S/c12-8-1-2-11(10(13)7-8)18(16,17)15-9-3-5-14-6-4-9/h1-7H,(H,14,15) |
| InChIKey | WGNPPGZTRZQJSE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |