C13H10Br3NO3S — CID 82861269
2,4-dibromo-N-(4-bromo-3-methoxyphenyl)benzenesulfonamide (PubChem CID 82861269) has the molecular formula C13H10Br3NO3S and a molecular weight of 500.01 g/mol. Its IUPAC name is 2,4-dibromo-N-(4-bromo-3-methoxyphenyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(4-bromo-3-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82861269 |
| Molecular Formula | C13H10Br3NO3S |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 496.79 |
| IUPAC Name | 2,4-dibromo-N-(4-bromo-3-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(Br)cc2Br)ccc1Br |
| InChI | InChI=1S/C13H10Br3NO3S/c1-20-12-7-9(3-4-10(12)15)17-21(18,19)13-5-2-8(14)6-11(13)16/h2-7,17H,1H3 |
| InChIKey | GMGKUFNUCHZNBO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |