C13H12Br2N2O3S — CID 60824367
N-(3-amino-4-methoxyphenyl)-2,4-dibromobenzenesulfonamide (PubChem CID 60824367) has the molecular formula C13H12Br2N2O3S and a molecular weight of 436.13 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2,4-dibromobenzenesulfonamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2,4-dibromobenzenesulfonamide |
|---|---|
| PubChem CID | 60824367 |
| Molecular Formula | C13H12Br2N2O3S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2,4-dibromobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Br)cc2Br)cc1N |
| InChI | InChI=1S/C13H12Br2N2O3S/c1-20-12-4-3-9(7-11(12)16)17-21(18,19)13-5-2-8(14)6-10(13)15/h2-7,17H,16H2,1H3 |
| InChIKey | OVDBBIVSQJSCMA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|