C13H11Br2NO2S — CID 47257416
2,4-dibromo-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 47257416) has the molecular formula C13H11Br2NO2S and a molecular weight of 405.11 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47257416 |
| Molecular Formula | C13H11Br2NO2S |
| Molecular Weight | 405.11 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 2,4-dibromo-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C13H11Br2NO2S/c1-9-3-2-4-11(7-9)16-19(17,18)13-6-5-10(14)8-12(13)15/h2-8,16H,1H3 |
| InChIKey | AJYBLWURODRARA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.11 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |