C12H8Br2INO2S — CID 60823302
2,4-dibromo-N-(3-iodophenyl)benzenesulfonamide (PubChem CID 60823302) has the molecular formula C12H8Br2INO2S and a molecular weight of 516.98 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-iodophenyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(3-iodophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60823302 |
| Molecular Formula | C12H8Br2INO2S |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 514.77 |
| IUPAC Name | 2,4-dibromo-N-(3-iodophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(I)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H8Br2INO2S/c13-8-4-5-12(11(14)6-8)19(17,18)16-10-3-1-2-9(15)7-10/h1-7,16H |
| InChIKey | DLPZSSZUFNOLJD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|