C14H11BrINO4S — CID 60605016
6-bromo-N-(3-iodophenyl)-2,3-dihydro-1,4-benzodioxine-7-sulfonamide (PubChem CID 60605016) has the molecular formula C14H11BrINO4S and a molecular weight of 496.12 g/mol. Its IUPAC name is 6-bromo-N-(3-iodophenyl)-2,3-dihydro-1,4-benzodioxine-7-sulfonamide.
| Compound Name | 6-bromo-N-(3-iodophenyl)-2,3-dihydro-1,4-benzodioxine-7-sulfonamide |
|---|---|
| PubChem CID | 60605016 |
| Molecular Formula | C14H11BrINO4S |
| Molecular Weight | 496.12 g/mol |
| Exact Mass | 494.86 |
| IUPAC Name | 6-bromo-N-(3-iodophenyl)-2,3-dihydro-1,4-benzodioxine-7-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(I)c1)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C14H11BrINO4S/c15-11-7-12-13(21-5-4-20-12)8-14(11)22(18,19)17-10-3-1-2-9(16)6-10/h1-3,6-8,17H,4-5H2 |
| InChIKey | FKTWSPICDUXDIC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|