C9H6Br2N2O3S — CID 55125549
2,4-dibromo-N-(1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 55125549) has the molecular formula C9H6Br2N2O3S and a molecular weight of 382.03 g/mol. Its IUPAC name is 2,4-dibromo-N-(1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55125549 |
| Molecular Formula | C9H6Br2N2O3S |
| Molecular Weight | 382.03 g/mol |
| Exact Mass | 379.85 |
| IUPAC Name | 2,4-dibromo-N-(1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnoc1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H6Br2N2O3S/c10-6-1-2-9(8(11)3-6)17(14,15)13-7-4-12-16-5-7/h1-5,13H |
| InChIKey | DSRMUIVARIELHH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.03 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |