C10H8Br2N2O3S — CID 80708187
2,5-dibromo-4-methyl-N-(1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 80708187) has the molecular formula C10H8Br2N2O3S and a molecular weight of 396.06 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 80708187 |
| Molecular Formula | C10H8Br2N2O3S |
| Molecular Weight | 396.06 g/mol |
| Exact Mass | 393.86 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2cnoc2)cc1Br |
| InChI | InChI=1S/C10H8Br2N2O3S/c1-6-2-9(12)10(3-8(6)11)18(15,16)14-7-4-13-17-5-7/h2-5,14H,1H3 |
| InChIKey | ZTLHXQBDXALECW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.06 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |