C13H9Br2Cl2NO2S — CID 81427019
2,5-dibromo-N-(3,5-dichlorophenyl)-4-methylbenzenesulfonamide (PubChem CID 81427019) has the molecular formula C13H9Br2Cl2NO2S and a molecular weight of 474.00 g/mol. Its IUPAC name is 2,5-dibromo-N-(3,5-dichlorophenyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3,5-dichlorophenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81427019 |
| Molecular Formula | C13H9Br2Cl2NO2S |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 470.81 |
| IUPAC Name | 2,5-dibromo-N-(3,5-dichlorophenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1Br |
| InChI | InChI=1S/C13H9Br2Cl2NO2S/c1-7-2-12(15)13(6-11(7)14)21(19,20)18-10-4-8(16)3-9(17)5-10/h2-6,18H,1H3 |
| InChIKey | QMQPSKIROLRLGH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |