C14H12Cl3NO2S — CID 22773548
4-chloro-N-(3,5-dichlorophenyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 22773548) has the molecular formula C14H12Cl3NO2S and a molecular weight of 364.68 g/mol. Its IUPAC name is 4-chloro-N-(3,5-dichlorophenyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(3,5-dichlorophenyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22773548 |
| Molecular Formula | C14H12Cl3NO2S |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 4-chloro-N-(3,5-dichlorophenyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)c(C)cc1Cl |
| InChI | InChI=1S/C14H12Cl3NO2S/c1-8-4-14(9(2)3-13(8)17)21(19,20)18-12-6-10(15)5-11(16)7-12/h3-7,18H,1-2H3 |
| InChIKey | LITNOOCAOVXLPO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |