C18H23ClN2O2S — CID 3810600
4-chloro-N-[4-(diethylamino)phenyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 3810600) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 4-chloro-N-[4-(diethylamino)phenyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[4-(diethylamino)phenyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3810600 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-chloro-N-[4-(diethylamino)phenyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2cc(C)c(Cl)cc2C)cc1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-5-21(6-2)16-9-7-15(8-10-16)20-24(22,23)18-12-13(3)17(19)11-14(18)4/h7-12,20H,5-6H2,1-4H3 |
| InChIKey | POSZZEZFIUPPEY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|