C21H27ClN2O4S — CID 22204210
2-(diethylamino)ethyl 4-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]benzoate (PubChem CID 22204210) has the molecular formula C21H27ClN2O4S and a molecular weight of 438.98 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 22204210 |
| Molecular Formula | C21H27ClN2O4S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(4-chloro-2,5-dimethylphenyl)sulfonylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NS(=O)(=O)c2cc(C)c(Cl)cc2C)cc1 |
| InChI | InChI=1S/C21H27ClN2O4S/c1-5-24(6-2)11-12-28-21(25)17-7-9-18(10-8-17)23-29(26,27)20-14-15(3)19(22)13-16(20)4/h7-10,13-14,23H,5-6,11-12H2,1-4H3 |
| InChIKey | PISNHPWGVFPTDJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |