C16H16ClNO5S — CID 15944040
4-[(5-chloro-2-ethoxy-4-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 15944040) has the molecular formula C16H16ClNO5S and a molecular weight of 369.83 g/mol. Its IUPAC name is 4-[(5-chloro-2-ethoxy-4-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[(5-chloro-2-ethoxy-4-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 15944040 |
| Molecular Formula | C16H16ClNO5S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-[(5-chloro-2-ethoxy-4-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCOc1cc(C)c(Cl)cc1S(=O)(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H16ClNO5S/c1-3-23-14-8-10(2)13(17)9-15(14)24(21,22)18-12-6-4-11(5-7-12)16(19)20/h4-9,18H,3H2,1-2H3,(H,19,20) |
| InChIKey | XOCFOANPPNSIDI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |