C15H14ClNO6S — CID 15944041
4-[(4-chloro-2,5-dimethoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 15944041) has the molecular formula C15H14ClNO6S and a molecular weight of 371.80 g/mol. Its IUPAC name is 4-[(4-chloro-2,5-dimethoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[(4-chloro-2,5-dimethoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 15944041 |
| Molecular Formula | C15H14ClNO6S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-[(4-chloro-2,5-dimethoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | COc1cc(S(=O)(=O)Nc2ccc(C(=O)O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C15H14ClNO6S/c1-22-12-8-14(13(23-2)7-11(12)16)24(20,21)17-10-5-3-9(4-6-10)15(18)19/h3-8,17H,1-2H3,(H,18,19) |
| InChIKey | LFMHGXZVBVXLJM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |