C18H18N2O6S — CID 99780414
4-[[4-(cyclopropanecarbonylamino)-2-methoxyphenyl]sulfonylamino]benzoic acid (PubChem CID 99780414) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 4-[[4-(cyclopropanecarbonylamino)-2-methoxyphenyl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[4-(cyclopropanecarbonylamino)-2-methoxyphenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 99780414 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-[[4-(cyclopropanecarbonylamino)-2-methoxyphenyl]sulfonylamino]benzoic acid |
| SMILES | COc1cc(NC(=O)C2CC2)ccc1S(=O)(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-26-15-10-14(19-17(21)11-2-3-11)8-9-16(15)27(24,25)20-13-6-4-12(5-7-13)18(22)23/h4-11,20H,2-3H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | RHAPTCDMPXQXMU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |