C16H17NO5S — CID 15944036
4-[(4-methoxy-2,3-dimethylphenyl)sulfonylamino]benzoic acid (PubChem CID 15944036) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[(4-methoxy-2,3-dimethylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[(4-methoxy-2,3-dimethylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 15944036 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[(4-methoxy-2,3-dimethylphenyl)sulfonylamino]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C(=O)O)cc2)c(C)c1C |
| InChI | InChI=1S/C16H17NO5S/c1-10-11(2)15(9-8-14(10)22-3)23(20,21)17-13-6-4-12(5-7-13)16(18)19/h4-9,17H,1-3H3,(H,18,19) |
| InChIKey | GZMLMVARDZJLKY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |