C20H26N2O3S — CID 100516902
4-methoxy-2,3-dimethyl-N-(4-piperidin-1-ylphenyl)benzenesulfonamide (PubChem CID 100516902) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-methoxy-2,3-dimethyl-N-(4-piperidin-1-ylphenyl)benzenesulfonamide.
| Compound Name | 4-methoxy-2,3-dimethyl-N-(4-piperidin-1-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100516902 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-methoxy-2,3-dimethyl-N-(4-piperidin-1-ylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N3CCCCC3)cc2)c(C)c1C |
| InChI | InChI=1S/C20H26N2O3S/c1-15-16(2)20(12-11-19(15)25-3)26(23,24)21-17-7-9-18(10-8-17)22-13-5-4-6-14-22/h7-12,21H,4-6,13-14H2,1-3H3 |
| InChIKey | LWGDVOMTTIWUHJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|