C21H23N3O5S — CID 100508329
3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide (PubChem CID 100508329) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100508329 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(4-pyrrolidin-1-ylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N3CCCC3)cc2)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C21H23N3O5S/c1-29-19-9-8-17(14-18(19)24-20(25)10-11-21(24)26)30(27,28)22-15-4-6-16(7-5-15)23-12-2-3-13-23/h4-9,14,22H,2-3,10-13H2,1H3 |
| InChIKey | VLRGCLJMMJKQIP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|