C25H31N3O5S — CID 100512511
3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]benzenesulfonamide (PubChem CID 100512511) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]benzenesulfonamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100512511 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C)c2ccc(N3CCC[C@@H](C)C3)cc2)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C25H31N3O5S/c1-17-5-4-14-27(16-17)20-8-6-19(7-9-20)18(2)26-34(31,32)21-10-11-23(33-3)22(15-21)28-24(29)12-13-25(28)30/h6-11,15,17-18,26H,4-5,12-14,16H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | GIIAZAMMLBDBSV-QZTJIDSGSA-N |
| XLogP | 3.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|