C20H22N2O5S — CID 100667946
3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide (PubChem CID 100667946) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100667946 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-[(1S)-1-(4-methylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)c2ccc(C)cc2)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C20H22N2O5S/c1-13-4-6-15(7-5-13)14(2)21-28(25,26)16-8-9-18(27-3)17(12-16)22-19(23)10-11-20(22)24/h4-9,12,14,21H,10-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | ZJBOTOYXZYUQLK-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|