C16H18FNO3S — CID 28958747
N-[(1S)-1-(4-fluorophenyl)ethyl]-4-methoxy-3-methylbenzenesulfonamide (PubChem CID 28958747) has the molecular formula C16H18FNO3S and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[(1S)-1-(4-fluorophenyl)ethyl]-4-methoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[(1S)-1-(4-fluorophenyl)ethyl]-4-methoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 28958747 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[(1S)-1-(4-fluorophenyl)ethyl]-4-methoxy-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C16H18FNO3S/c1-11-10-15(8-9-16(11)21-3)22(19,20)18-12(2)13-4-6-14(17)7-5-13/h4-10,12,18H,1-3H3/t12-/m0/s1 |
| InChIKey | YIFMKFMQLDHUTI-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |