C17H21NO3S2 — CID 43874224
4-methoxy-3-methyl-N-[1-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide (PubChem CID 43874224) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-[1-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-[1-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43874224 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 4-methoxy-3-methyl-N-[1-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2ccc(SC)cc2)cc1C |
| InChI | InChI=1S/C17H21NO3S2/c1-12-11-16(9-10-17(12)21-3)23(19,20)18-13(2)14-5-7-15(22-4)8-6-14/h5-11,13,18H,1-4H3 |
| InChIKey | ZKESEILMRFWBNR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |