C16H18BrNO5S2 — CID 133165455
3-bromo-4-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide (PubChem CID 133165455) has the molecular formula C16H18BrNO5S2 and a molecular weight of 448.36 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133165455 |
| Molecular Formula | C16H18BrNO5S2 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 3-bromo-4-methoxy-N-[1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)cc1Br |
| InChI | InChI=1S/C16H18BrNO5S2/c1-11(12-4-6-13(7-5-12)24(3,19)20)18-25(21,22)14-8-9-16(23-2)15(17)10-14/h4-11,18H,1-3H3 |
| InChIKey | DGYGLXAZUSLXRR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |