C15H15BrClNO3S — CID 28560375
N-[(1S)-1-(4-bromophenyl)ethyl]-3-chloro-4-methoxybenzenesulfonamide (PubChem CID 28560375) has the molecular formula C15H15BrClNO3S and a molecular weight of 404.71 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-3-chloro-4-methoxybenzenesulfonamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-3-chloro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 28560375 |
| Molecular Formula | C15H15BrClNO3S |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-3-chloro-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C15H15BrClNO3S/c1-10(11-3-5-12(16)6-4-11)18-22(19,20)13-7-8-15(21-2)14(17)9-13/h3-10,18H,1-2H3/t10-/m0/s1 |
| InChIKey | NKXIXGSNRBBVNP-JTQLQIEISA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |