C12H18ClNO4S — CID 79255139
3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide (PubChem CID 79255139) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is 3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 79255139 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(CO)C(C)C)cc1Cl |
| InChI | InChI=1S/C12H18ClNO4S/c1-8(2)11(7-15)14-19(16,17)9-4-5-12(18-3)10(13)6-9/h4-6,8,11,14-15H,7H2,1-3H3 |
| InChIKey | AHQMFWVHNXZLMV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |