C12H18ClNO4S2 — CID 103861133
3-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-methoxybenzenesulfonamide (PubChem CID 103861133) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 3-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103861133 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C(CO)SC)cc1Cl |
| InChI | InChI=1S/C12H18ClNO4S2/c1-8(12(7-15)19-3)14-20(16,17)9-4-5-11(18-2)10(13)6-9/h4-6,8,12,14-15H,7H2,1-3H3 |
| InChIKey | XESILMACIKARAV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |