C12H15ClN2O3S2 — CID 103861189
3-chloro-4-cyano-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 103861189) has the molecular formula C12H15ClN2O3S2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103861189 |
| Molecular Formula | C12H15ClN2O3S2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-chloro-4-cyano-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CSC(CO)C(C)NS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2O3S2/c1-8(12(7-16)19-2)15-20(17,18)10-4-3-9(6-14)11(13)5-10/h3-5,8,12,15-16H,7H2,1-2H3 |
| InChIKey | ZDQYQYAFVFETQQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |