C11H15ClN2O5S2 — CID 103912573
2-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-nitrobenzenesulfonamide (PubChem CID 103912573) has the molecular formula C11H15ClN2O5S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 103912573 |
| Molecular Formula | C11H15ClN2O5S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-chloro-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-4-nitrobenzenesulfonamide |
| SMILES | CSC(CO)C(C)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H15ClN2O5S2/c1-7(10(6-15)20-2)13-21(18,19)11-4-3-8(14(16)17)5-9(11)12/h3-5,7,10,13,15H,6H2,1-2H3 |
| InChIKey | BJZSMSWDOKMAEA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|