C11H16BrNO3S2 — CID 113340729
3-bromo-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 113340729) has the molecular formula C11H16BrNO3S2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 3-bromo-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 3-bromo-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113340729 |
| Molecular Formula | C11H16BrNO3S2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-bromo-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CSC(CO)C(C)NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO3S2/c1-8(11(7-14)17-2)13-18(15,16)10-5-3-4-9(12)6-10/h3-6,8,11,13-14H,7H2,1-2H3 |
| InChIKey | NUQHFLORXRJYOK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |