C13H20BrNO4S2 — CID 103912575
5-bromo-2-ethoxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 103912575) has the molecular formula C13H20BrNO4S2 and a molecular weight of 398.34 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103912575 |
| Molecular Formula | C13H20BrNO4S2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 5-bromo-2-ethoxy-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NC(C)C(CO)SC |
| InChI | InChI=1S/C13H20BrNO4S2/c1-4-19-11-6-5-10(14)7-13(11)21(17,18)15-9(2)12(8-16)20-3/h5-7,9,12,15-16H,4,8H2,1-3H3 |
| InChIKey | MJIBNSCZGQZHNK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |