C11H16BrNO2S — CID 92510419
3-bromo-N-[(2S)-pentan-2-yl]benzenesulfonamide (PubChem CID 92510419) has the molecular formula C11H16BrNO2S and a molecular weight of 306.23 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-pentan-2-yl]benzenesulfonamide.
| Compound Name | 3-bromo-N-[(2S)-pentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 92510419 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-bromo-N-[(2S)-pentan-2-yl]benzenesulfonamide |
| SMILES | CCC[C@H](C)NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO2S/c1-3-5-9(2)13-16(14,15)11-7-4-6-10(12)8-11/h4,6-9,13H,3,5H2,1-2H3/t9-/m0/s1 |
| InChIKey | UNAFXJVTBWWYSY-VIFPVBQESA-N |
| XLogP | 2.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |